Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10699 RXN-10699] == * direction: ** left-to-right * common-name: ** 3-oxoacyl coa thiolase ** a...")
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10699 RXN-10699] ==
+
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxoacyl coa thiolase
+
** 2,4-dinitrophenyl-s-glutathione
−
** acetyl-coa c-acyltransferase
+
* smiles:
−
* ec-number:
+
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
−
** [http://enzyme.expasy.org/EC/2.3.1.16 ec-2.3.1.16]
+
* inchi-key:
−
== Reaction formula ==
+
** fxeukvkgtkddiq-uwvggrqhsa-m
−
* 1 [[CO-A]][c] '''+''' 1 [[CPD-11520]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-11521]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 472.406
−
* Gene: [[SJ16470]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[GST-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ21818]]
+
* [[GST-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
−
* Gene: [[SJ14898]]
+
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=472.406}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ09371]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ21817]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=3-oxoacyl coa thiolase|acetyl-coa c-acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.16}}
 
−
{{#set: nb gene associated=5}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite S-24-DINITROPHENYLGLUTATHIONE

  • common-name:
    • 2,4-dinitrophenyl-s-glutathione
  • smiles:
    • c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
  • inchi-key:
    • fxeukvkgtkddiq-uwvggrqhsa-m
  • molecular-weight:
    • 472.406

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-24-DINITROPHENYLGLUTATHIONE&oldid=139500"