Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13142 RXN-13142] == * direction: ** left-to-right * common-name: ** nadphx epimerase * ec-numbe...") |
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite S-24-DINITROPHENYLGLUTATHIONE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 2,4-dinitrophenyl-s-glutathione |
| − | * | + | * smiles: |
| − | ** [ | + | ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1) |
| − | == | + | * inchi-key: |
| − | + | ** fxeukvkgtkddiq-uwvggrqhsa-m | |
| − | = | + | * molecular-weight: |
| − | + | ** 472.406 | |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[GST-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[GST-RXN]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=2,4-dinitrophenyl-s-glutathione}} |
| − | ** | + | {{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}} |
| − | + | {{#set: molecular-weight=472.406}} | |
| − | == | ||
| − | |||
| − | * | ||
| − | == | ||
| − | * | ||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- common-name:
- 2,4-dinitrophenyl-s-glutathione
- smiles:
- c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
- inchi-key:
- fxeukvkgtkddiq-uwvggrqhsa-m
- molecular-weight:
- 472.406
