Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8609 == * common-name: ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c2(=c(cc1)c3(c)(...")
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8609 ==
+
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
 
* common-name:
 
* common-name:
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
+
** 2,4-dinitrophenyl-s-glutathione
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)(c(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))=cc4)))c
+
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 
* inchi-key:
 
* inchi-key:
** ogqjuyxfioftma-pbjlwwpksa-n
+
** fxeukvkgtkddiq-uwvggrqhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 412.698
+
** 472.406
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-14]]
+
* [[GST-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13707]]
+
* [[GST-RXN]]
* [[RXN66-13]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
+
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
{{#set: inchi-key=inchikey=ogqjuyxfioftma-pbjlwwpksa-n}}
+
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
{{#set: molecular-weight=412.698}}
+
{{#set: molecular-weight=472.406}}

Latest revision as of 11:17, 18 March 2021

Metabolite S-24-DINITROPHENYLGLUTATHIONE

  • common-name:
    • 2,4-dinitrophenyl-s-glutathione
  • smiles:
    • c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
  • inchi-key:
    • fxeukvkgtkddiq-uwvggrqhsa-m
  • molecular-weight:
    • 472.406

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality