Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite TYRAMINE == * common-name: ** tyramine * smiles: ** c1(c=c(o)c=cc(cc[n+])=1) * inchi-key: ** dzgwfcgjzkjufp-uhfffaoysa-o * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12461 ==
+
== Metabolite TYRAMINE ==
 +
* common-name:
 +
** tyramine
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
+
** c1(c=c(o)c=cc(cc[n+])=1)
* common-name:
+
* inchi-key:
** tri-trans,hepta-cis-undecaprenyl diphosphate
+
** dzgwfcgjzkjufp-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 924.251
+
** 138.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-5821]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11488]]
+
* [[TYROSINE-DECARBOXYLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=tyramine}}
{{#set: molecular-weight=924.251}}
+
{{#set: inchi-key=inchikey=dzgwfcgjzkjufp-uhfffaoysa-o}}
 +
{{#set: molecular-weight=138.189}}

Revision as of 08:24, 15 March 2021

Metabolite TYRAMINE

  • common-name:
    • tyramine
  • smiles:
    • c1(c=c(o)c=cc(cc[n+])=1)
  • inchi-key:
    • dzgwfcgjzkjufp-uhfffaoysa-o
  • molecular-weight:
    • 138.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality