Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21972 == * transcription-direction: ** positive * right-end-position: ** 248261 * left-end-position: ** 242033 * centisome-position: ** 41.227844...")
(Created page with "Category:metabolite == Metabolite S-3-HYDROXYBUTANOYL-COA == * common-name: ** (s)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21972 ==
+
== Metabolite S-3-HYDROXYBUTANOYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** (s)-3-hydroxybutanoyl-coa
* right-end-position:
+
* smiles:
** 248261
+
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
* left-end-position:
+
* inchi-key:
** 242033
+
** qhhkkmyhdbrony-vkbdfprvsa-j
* centisome-position:
+
* molecular-weight:
** 41.227844   
+
** 849.593
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[HACD1h]]
== Reaction(s) associated ==
+
* [[HBCHL]]
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[HBCHLm]]
* [[1.1.1.145-RXN]]
+
* [[HBCO]]
** Category: [[annotation]]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[RXN-11662]]
** Category: [[orthology]]
+
* [[RXN-11667]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
* [[RXN-1101]]
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
** Category: [[orthology]]
+
* [[HACD1h]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[HBCHL]]
* [[RXN-1106]]
+
* [[HBCHLm]]
** Category: [[orthology]]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
* [[RXN-1124]]
+
* [[RXN-11662]]
** Category: [[orthology]]
+
* [[RXN-11667]]
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-12693]]
+
{{#set: common-name=(s)-3-hydroxybutanoyl-coa}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-vkbdfprvsa-j}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=849.593}}
* [[RXN-12747]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12789]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-600]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-7784]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-9725]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN66-342]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN66-350]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN66-353]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[PWY1F-823]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-361]]
 
** '''7''' reactions found over '''15''' reactions in the full pathway
 
* [[PWY-6027]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-6946]]
 
** '''6''' reactions found over '''22''' reactions in the full pathway
 
* [[PWY-6944]]
 
** '''2''' reactions found over '''25''' reactions in the full pathway
 
* [[PWY-6948]]
 
** '''2''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-5152]]
 
** '''2''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-6035]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY66-378]]
 
** '''3''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-7299]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=248261}}
 
{{#set: left-end-position=242033}}
 
{{#set: centisome-position=41.227844    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=14}}
 
{{#set: nb pathway associated=10}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite S-3-HYDROXYBUTANOYL-COA

  • common-name:
    • (s)-3-hydroxybutanoyl-coa
  • smiles:
    • cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • qhhkkmyhdbrony-vkbdfprvsa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality