Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06064 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == <div class="toccolours mw-co...")
 
(Created page with "Category:metabolite == Metabolite S-3-HYDROXYBUTANOYL-COA == * common-name: ** (s)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06064 ==
+
== Metabolite S-3-HYDROXYBUTANOYL-COA ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** (s)-3-hydroxybutanoyl-coa
−
== Reaction(s) associated ==
+
* smiles:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
−
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* inchi-key:
−
** Category: [[orthology]]
+
** qhhkkmyhdbrony-vkbdfprvsa-j
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* molecular-weight:
−
* [[RXN-1101]]
+
** 849.593
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HACD1h]]
−
* [[RXN-1106]]
+
* [[HBCHL]]
−
** Category: [[orthology]]
+
* [[HBCHLm]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HBCO]]
−
* [[RXN-1124]]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
−
** Category: [[orthology]]
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-11662]]
−
* [[RXN-17678]]
+
* [[RXN-11667]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
−
* [[RXN-600]]
+
* [[HACD1h]]
−
** Category: [[orthology]]
+
* [[HBCHL]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HBCHLm]]
−
* [[RXN-7784]]
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
−
** Category: [[orthology]]
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-11662]]
−
* [[RXN-9725]]
+
* [[RXN-11667]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(s)-3-hydroxybutanoyl-coa}}
−
</div>
+
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-vkbdfprvsa-j}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=849.593}}
−
* [[PWY1F-823]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-361]]
 
−
** '''7''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-6027]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5152]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6035]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite S-3-HYDROXYBUTANOYL-COA

  • common-name:
    • (s)-3-hydroxybutanoyl-coa
  • smiles:
    • cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • qhhkkmyhdbrony-vkbdfprvsa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-3-HYDROXYBUTANOYL-COA&oldid=137028"