Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20677 == * transcription-direction: ** negative * right-end-position: ** 68613 * left-end-position: ** 36731 * centisome-position: ** 17.935759...") |
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-181 == |
| − | * | + | * common-name: |
| − | ** | + | ** 4-methylumbelliferyl acetate |
| − | * | + | * smiles: |
| − | ** | + | ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hxvzgascdagaps-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 218.209 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[3.1.1.56-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=4-methylumbelliferyl acetate}} | |
| − | + | {{#set: inchi-key=inchikey=hxvzgascdagaps-uhfffaoysa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=218.209}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-181
- common-name:
- 4-methylumbelliferyl acetate
- smiles:
- cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o)
- inchi-key:
- hxvzgascdagaps-uhfffaoysa-n
- molecular-weight:
- 218.209
