Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11540 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** udp-4-dehydro-β-l-rhamnose |
* smiles: | * smiles: | ||
− | ** | + | ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ddwgqqadoimfoi-tyenrrdnsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 546.274 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10740]] |
+ | * [[RXN-18332]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-18332]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=udp-4-dehydro-β-l-rhamnose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=546.274}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-11540
- common-name:
- udp-4-dehydro-β-l-rhamnose
- smiles:
- cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
- inchi-key:
- ddwgqqadoimfoi-tyenrrdnsa-l
- molecular-weight:
- 546.274