Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-729 == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) * inchi-key: ** pmtmafapl...") |
(Created page with "Category:metabolite == Metabolite R-NORCOCLAURINE == * common-name: ** (r)-norcoclaurine * smiles: ** c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3)) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-NORCOCLAURINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-norcoclaurine |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wzrcqwqrfzitdx-cqszacivsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 272.323 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5141]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-norcoclaurine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wzrcqwqrfzitdx-cqszacivsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=272.323}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite R-NORCOCLAURINE
- common-name:
- (r)-norcoclaurine
- smiles:
- c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3))
- inchi-key:
- wzrcqwqrfzitdx-cqszacivsa-o
- molecular-weight:
- 272.323
