Difference between revisions of "S-3-HYDROXYBUTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20677 == * transcription-direction: ** negative * right-end-position: ** 68613 * left-end-position: ** 36731 * centisome-position: ** 17.935759...")
(Created page with "Category:metabolite == Metabolite S-3-HYDROXYBUTANOYL-COA == * common-name: ** (s)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20677 ==
+
== Metabolite S-3-HYDROXYBUTANOYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (s)-3-hydroxybutanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 68613
+
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
−
* left-end-position:
+
* inchi-key:
−
** 36731
+
** qhhkkmyhdbrony-vkbdfprvsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 17.935759   
+
** 849.593
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[HACD1h]]
−
== Reaction(s) associated ==
+
* [[HBCHL]]
−
* [[3.4.19.12-RXN]]
+
* [[HBCHLm]]
−
** Category: [[annotation]]
+
* [[HBCO]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HBCO_LPAREN_nadp_RPAREN_]]
−
{{#set: transcription-direction=negative}}
+
* [[HBCO_LPAREN_nadp_RPAREN_m]]
−
{{#set: right-end-position=68613}}
+
* [[RXN-11662]]
−
{{#set: left-end-position=36731}}
+
* [[RXN-11667]]
−
{{#set: centisome-position=17.935759    }}
+
== Reaction(s) known to produce the compound ==
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
−
{{#set: nb reaction associated=1}}
+
* [[HACD1h]]
 +
* [[HBCHL]]
 +
* [[HBCHLm]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_]]
 +
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 +
* [[RXN-11662]]
 +
* [[RXN-11667]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(s)-3-hydroxybutanoyl-coa}}
 +
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-vkbdfprvsa-j}}
 +
{{#set: molecular-weight=849.593}}

Latest revision as of 11:11, 18 March 2021

Metabolite S-3-HYDROXYBUTANOYL-COA

  • common-name:
    • (s)-3-hydroxybutanoyl-coa
  • smiles:
    • cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
  • inchi-key:
    • qhhkkmyhdbrony-vkbdfprvsa-j
  • molecular-weight:
    • 849.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-3-HYDROXYBUTANOYL-COA&oldid=137028"