Difference between revisions of "S-ACETYLDIHYDROLIPOAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite S-ACETYLDIHYDROLIPOAMIDE == * common-name: ** s-acetyldihydrolipoamide * smiles: ** cc(sc(ccs)ccccc(n)=o)=o * inchi-key: ** argxexvchmnaq...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite S-ACETYLDIHYDROLIPOAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** s-acetyldihydrolipoamide |
* smiles: | * smiles: | ||
− | ** | + | ** cc(sc(ccs)ccccc(n)=o)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** argxexvchmnaqu-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 249.386 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[DIHYDLIPACETRANS-RXN]] |
+ | * [[PDHam2hi]] | ||
+ | * [[PDHam2mi]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=s-acetyldihydrolipoamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=argxexvchmnaqu-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=249.386}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite S-ACETYLDIHYDROLIPOAMIDE
- common-name:
- s-acetyldihydrolipoamide
- smiles:
- cc(sc(ccs)ccccc(n)=o)=o
- inchi-key:
- argxexvchmnaqu-uhfffaoysa-n
- molecular-weight:
- 249.386