Difference between revisions of "S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06815 == * transcription-direction: ** negative * right-end-position: ** 50302 * left-end-position: ** 36386 * centisome-position: ** 48.66 ==...")
(Created page with "Category:metabolite == Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE == * common-name: ** s-adenosyl-4-methylthio-2-oxobutanoate * smiles: ** c[s+](ccc(c([o-])=o)=o)cc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06815 ==
+
== Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE ==
* transcription-direction:
+
* common-name:
** negative
+
** s-adenosyl-4-methylthio-2-oxobutanoate
* right-end-position:
+
* smiles:
** 50302
+
** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
* left-end-position:
+
* inchi-key:
** 36386
+
** uokvqqmbgvmxpu-cjpdyehrsa-n
* centisome-position:
+
* molecular-weight:
** 48.66   
+
** 397.405
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[DAPASYN-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
+
* [[DAPASYN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}}
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
{{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}}
** Category: [[annotation]]
+
{{#set: molecular-weight=397.405}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-13698]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[ALANINE-SYN2-PWY]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[ALANINE-DEG3-PWY]]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
* [[ALACAT2-PWY]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-7117]]
 
** '''10''' reactions found over '''12''' reactions in the full pathway
 
* [[PWY-7115]]
 
** '''9''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-7383]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=50302}}
 
{{#set: left-end-position=36386}}
 
{{#set: centisome-position=48.66    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE

  • common-name:
    • s-adenosyl-4-methylthio-2-oxobutanoate
  • smiles:
    • c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
  • inchi-key:
    • uokvqqmbgvmxpu-cjpdyehrsa-n
  • molecular-weight:
    • 397.405

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality