Difference between revisions of "S-ADENOSYLMETHIONINAMINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10908 RXN-10908] == * direction: ** left-to-right * common-name: ** adrenaline oxidase * ec-num...") |
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite S-ADENOSYLMETHIONINAMINE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** s-adenosyl 3-(methylthio)propylamine |
− | * | + | * smiles: |
− | ** [ | + | ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
− | == | + | * inchi-key: |
− | * | + | ** zunbitixdcpnsd-lsrjevitsa-o |
− | == | + | * molecular-weight: |
− | * | + | ** 356.442 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[APAPT]] |
− | == | + | * [[RXN-11190]] |
− | * [[ | + | * [[RXN0-5217]] |
− | * | + | * [[SPERMIDINESYN-RXN]] |
− | + | * [[SPERMINE-SYNTHASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[AMCL]] |
− | + | * [[RXN-11190]] | |
− | + | * [[SAMDECARB-RXN]] | |
− | + | * [[SPERMIDINESYN-RXN]] | |
− | {{#set: common-name= | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=s-adenosyl 3-(methylthio)propylamine}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}} |
− | + | {{#set: molecular-weight=356.442}} | |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- common-name:
- s-adenosyl 3-(methylthio)propylamine
- smiles:
- c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- zunbitixdcpnsd-lsrjevitsa-o
- molecular-weight:
- 356.442