Difference between revisions of "S-ADENOSYLMETHIONINAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Benzenediols == * common-name: ** a benzenediol == Reaction(s) known to consume the compound == * LACCASE-RXN == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-ADENOSYLMETHIONINAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-adenosyl 3-(methylthio)propylamine |
| + | * smiles: | ||
| + | ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) | ||
| + | * inchi-key: | ||
| + | ** zunbitixdcpnsd-lsrjevitsa-o | ||
| + | * molecular-weight: | ||
| + | ** 356.442 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[APAPT]] |
| + | * [[RXN-11190]] | ||
| + | * [[RXN0-5217]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
| + | * [[SPERMINE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[AMCL]] | ||
| + | * [[RXN-11190]] | ||
| + | * [[SAMDECARB-RXN]] | ||
| + | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-adenosyl 3-(methylthio)propylamine}} |
| + | {{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}} | ||
| + | {{#set: molecular-weight=356.442}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- common-name:
- s-adenosyl 3-(methylthio)propylamine
- smiles:
- c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- zunbitixdcpnsd-lsrjevitsa-o
- molecular-weight:
- 356.442
