Difference between revisions of "S-ADENOSYLMETHIONINAMINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01852 == * transcription-direction: ** positive * right-end-position: ** 520934 * left-end-position: ** 515916 * centisome-position: ** 94.10456...") |
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite S-ADENOSYLMETHIONINAMINE == |
| − | * | + | * common-name: |
| − | ** | + | ** s-adenosyl 3-(methylthio)propylamine |
| − | * | + | * smiles: |
| − | ** | + | ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** zunbitixdcpnsd-lsrjevitsa-o |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 356.442 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[APAPT]] |
| − | + | * [[RXN-11190]] | |
| − | * [[ | + | * [[RXN0-5217]] |
| − | * | + | * [[SPERMIDINESYN-RXN]] |
| − | * | + | * [[SPERMINE-SYNTHASE-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[AMCL]] |
| − | + | * [[RXN-11190]] | |
| − | {{#set: | + | * [[SAMDECARB-RXN]] |
| − | + | * [[SPERMIDINESYN-RXN]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=s-adenosyl 3-(methylthio)propylamine}} |
| − | + | {{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}} | |
| + | {{#set: molecular-weight=356.442}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite S-ADENOSYLMETHIONINAMINE
- common-name:
- s-adenosyl 3-(methylthio)propylamine
- smiles:
- c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- zunbitixdcpnsd-lsrjevitsa-o
- molecular-weight:
- 356.442
