Difference between revisions of "S-ADENOSYLMETHIONINAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10908 RXN-10908] == * direction: ** left-to-right * common-name: ** adrenaline oxidase * ec-num...")
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10908 RXN-10908] ==
+
== Metabolite S-ADENOSYLMETHIONINAMINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** adrenaline oxidase
+
** s-adenosyl 3-(methylthio)propylamine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.4 ec-1.4.3.4]
+
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[L-EPINEPHRINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIHYDROXYPHENYLGLYCOLALDEHYDE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[METHYLAMINE]][c]
+
** zunbitixdcpnsd-lsrjevitsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07831]]
+
** 356.442
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[APAPT]]
−
== Pathway(s) ==
+
* [[RXN-11190]]
−
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
+
* [[RXN0-5217]]
−
** '''8''' reactions found over '''13''' reactions in the full pathway
+
* [[SPERMIDINESYN-RXN]]
−
== Reconstruction information  ==
+
* [[SPERMINE-SYNTHASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[AMCL]]
−
* LIGAND-RXN:
+
* [[RXN-11190]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R02919 R02919]
+
* [[SAMDECARB-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[SPERMIDINESYN-RXN]]
−
{{#set: common-name=adrenaline oxidase}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: ec-number=ec-1.4.3.4}}
+
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
−
{{#set: nb pathway associated=1}}
+
{{#set: molecular-weight=356.442}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite S-ADENOSYLMETHIONINAMINE

  • common-name:
    • s-adenosyl 3-(methylthio)propylamine
  • smiles:
    • c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
  • inchi-key:
    • zunbitixdcpnsd-lsrjevitsa-o
  • molecular-weight:
    • 356.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-ADENOSYLMETHIONINAMINE&oldid=138413"