Difference between revisions of "S-ADENOSYLMETHIONINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6972 == * common-name: ** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa * smiles: ** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc...")
(Created page with "Category:metabolite == Metabolite CPD0-1065 == * common-name: ** aminopropylcadaverine * smiles: ** c(cc[n+]ccccc[n+])[n+] * inchi-key: ** qzbyoyprovgoge-uhfffaoysa-q * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6972 ==
+
== Metabolite CPD0-1065 ==
 
* common-name:
 
* common-name:
** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
+
** aminopropylcadaverine
 
* smiles:
 
* smiles:
** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
+
** c(cc[n+]ccccc[n+])[n+]
 
* inchi-key:
 
* inchi-key:
** kvaqapqxoxtrae-uhfffaoysa-i
+
** qzbyoyprovgoge-uhfffaoysa-q
 
* molecular-weight:
 
* molecular-weight:
** 966.676
+
** 162.298
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAPHTHOATE-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NPHS]]
+
* [[RXN0-5217]]
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 
* [[RXN-7614]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2'-carboxyphenyl)-4-oxobutyryl-coa}}
+
{{#set: common-name=aminopropylcadaverine}}
{{#set: inchi-key=inchikey=kvaqapqxoxtrae-uhfffaoysa-i}}
+
{{#set: inchi-key=inchikey=qzbyoyprovgoge-uhfffaoysa-q}}
{{#set: molecular-weight=966.676}}
+
{{#set: molecular-weight=162.298}}

Revision as of 08:25, 15 March 2021

Metabolite CPD0-1065

  • common-name:
    • aminopropylcadaverine
  • smiles:
    • c(cc[n+]ccccc[n+])[n+]
  • inchi-key:
    • qzbyoyprovgoge-uhfffaoysa-q
  • molecular-weight:
    • 162.298

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality