Difference between revisions of "S-ADENOSYLMETHIONINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINE == * common-name: ** s-adenosyl-l-methionine == Reaction(s) known to consume the compound == <div class="toccolours...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACRYLYL-COA ==
+
== Metabolite S-ADENOSYLMETHIONINE ==
 
* common-name:
 
* common-name:
** acryloyl-coa
+
** s-adenosyl-l-methionine
* smiles:
 
** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** poodsgumucvrtr-iexphmlfsa-j
 
* molecular-weight:
 
** 817.551
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPCOAOm]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[RXN-6383]]
+
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 +
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 +
* [[2.1.1.100-RXN]]
 +
* [[2.1.1.113-RXN]]
 +
* [[2.1.1.114-RXN]]
 +
* [[2.1.1.115-RXN]]
 +
* [[2.1.1.124-RXN]]
 +
* [[2.1.1.125-RXN]]
 +
* [[2.1.1.126-RXN]]
 +
* [[2.1.1.127-RXN]]
 +
* [[2.1.1.128-RXN]]
 +
* [[2.1.1.137-RXN]]
 +
* [[2.1.1.138-RXN]]
 +
* [[2.1.1.140-RXN]]
 +
* [[2.1.1.143-RXN]]
 +
* [[2.1.1.17-RXN]]
 +
* [[2.1.1.34-RXN]]
 +
* [[2.1.1.57-RXN]]
 +
* [[2.1.1.62-RXN]]
 +
* [[2.1.1.64-RXN]]
 +
* [[2.1.1.71-RXN]]
 +
* [[2.1.1.72-RXN]]
 +
* [[2.1.1.77-RXN]]
 +
* [[2.1.1.79-RXN]]
 +
* [[2.8.1.6-RXN]]
 +
* [[4.4.1.14-RXN]]
 +
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
 +
* [[AMCL]]
 +
* [[AMETt2h]]
 +
* [[AMETt2m]]
 +
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 +
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[DAPASYN-RXN]]
 +
* [[DHHB-METHYLTRANSFER-RXN]]
 +
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 +
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HEMN-RXN]]
 +
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[MRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 +
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 +
* [[QUERCETIN-3-O-METHYLTRANSFERASE-RXN]]
 +
* [[RXN-1104]]
 +
* [[RXN-11046]]
 +
* [[RXN-11241]]
 +
* [[RXN-11267]]
 +
* [[RXN-11268]]
 +
* [[RXN-11319]]
 +
* [[RXN-11370]]
 +
* [[RXN-11371]]
 +
* [[RXN-11373]]
 +
* [[RXN-11374]]
 +
* [[RXN-1143]]
 +
* [[RXN-11475]]
 +
* [[RXN-11574]]
 +
* [[RXN-11578]]
 +
* [[RXN-11586]]
 +
* [[RXN-11592]]
 +
* [[RXN-11596]]
 +
* [[RXN-11598]]
 +
* [[RXN-11601]]
 +
* [[RXN-11602]]
 +
* [[RXN-11633]]
 +
* [[RXN-11634]]
 +
* [[RXN-11637]]
 +
* [[RXN-11638]]
 +
* [[RXN-11754]]
 +
* [[RXN-11757]]
 +
* [[RXN-11758]]
 +
* [[RXN-11855]]
 +
* [[RXN-11856]]
 +
* [[RXN-11860]]
 +
* [[RXN-11865]]
 +
* [[RXN-11866]]
 +
* [[RXN-11868]]
 +
* [[RXN-12160]]
 +
* [[RXN-12374]]
 +
* [[RXN-12375]]
 +
* [[RXN-12376]]
 +
* [[RXN-12377]]
 +
* [[RXN-12378]]
 +
* [[RXN-12379]]
 +
* [[RXN-12380]]
 +
* [[RXN-12381]]
 +
* [[RXN-12382]]
 +
* [[RXN-12458]]
 +
* [[RXN-12459]]
 +
* [[RXN-12461]]
 +
* [[RXN-12466]]
 +
* [[RXN-12469]]
 +
* [[RXN-12477]]
 +
* [[RXN-12478]]
 +
* [[RXN-12479]]
 +
* [[RXN-12889]]
 +
* [[RXN-12890]]
 +
* [[RXN-13224]]
 +
* [[RXN-13225]]
 +
* [[RXN-13226]]
 +
* [[RXN-13227]]
 +
* [[RXN-13228]]
 +
* [[RXN-13327]]
 +
* [[RXN-13403]]
 +
* [[RXN-13404]]
 +
* [[RXN-13405]]
 +
* [[RXN-13406]]
 +
* [[RXN-13588]]
 +
* [[RXN-13725]]
 +
* [[RXN-13726]]
 +
* [[RXN-13727]]
 +
* [[RXN-13935]]
 +
* [[RXN-14177]]
 +
* [[RXN-14326]]
 +
* [[RXN-14480]]
 +
* [[RXN-14481]]
 +
* [[RXN-14517]]
 +
* [[RXN-14518]]
 +
* [[RXN-14520]]
 +
* [[RXN-14528]]
 +
* [[RXN-14539]]
 +
* [[RXN-14540]]
 +
* [[RXN-14549]]
 +
* [[RXN-14550]]
 +
* [[RXN-14917]]
 +
* [[RXN-14918]]
 +
* [[RXN-14919]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-14992]]
 +
* [[RXN-15775]]
 +
* [[RXN-15842]]
 +
* [[RXN-15843]]
 +
* [[RXN-15844]]
 +
* [[RXN-16889]]
 +
* [[RXN-16891]]
 +
* [[RXN-16892]]
 +
* [[RXN-17120]]
 +
* [[RXN-17121]]
 +
* [[RXN-17472]]
 +
* [[RXN-17473]]
 +
* [[RXN-2542]]
 +
* [[RXN-2562]]
 +
* [[RXN-2762]]
 +
* [[RXN-3422]]
 +
* [[RXN-4021]]
 +
* [[RXN-5141]]
 +
* [[RXN-7421]]
 +
* [[RXN-8340]]
 +
* [[RXN-8675]]
 +
* [[RXN-9191]]
 +
* [[RXN-9205]]
 +
* [[RXN-9220]]
 +
* [[RXN-9225]]
 +
* [[RXN-9227]]
 +
* [[RXN-9229]]
 +
* [[RXN-9233]]
 +
* [[RXN-9235]]
 +
* [[RXN-9237]]
 +
* [[RXN-9240]]
 +
* [[RXN-9242]]
 +
* [[RXN-9280]]
 +
* [[RXN-9281]]
 +
* [[RXN-9282]]
 +
* [[RXN-9287]]
 +
* [[RXN-9361]]
 +
* [[RXN-9362]]
 +
* [[RXN-9363]]
 +
* [[RXN-9366]]
 +
* [[RXN-9679]]
 +
* [[RXN-9680]]
 +
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-5144]]
 +
* [[RXN0-5419]]
 +
* [[RXN0-6731]]
 +
* [[RXN0-6950]]
 +
* [[RXN0-949]]
 +
* [[RXN1G-2544]]
 +
* [[RXN1G-3641]]
 +
* [[RXN3O-102]]
 +
* [[RXN3O-178]]
 +
* [[RXN3O-54]]
 +
* [[RXN4FS-2]]
 +
* [[SAMDECARB-RXN]]
 +
* [[THIOL-S-METHYLTRANSFERASE-RXN]]
 +
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 +
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
 +
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 +
* [[UROPORIIIMETHYLTRANSA-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PPCOAOm]]
+
* [[2.1.1.135-RXN]]
* [[RXN-6383]]
+
* [[AMETt2h]]
 +
* [[AMETt2m]]
 +
* [[DAPASYN-RXN]]
 +
* [[RXN-17120]]
 +
* [[RXN-17121]]
 +
* [[S-ADENMETSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acryloyl-coa}}
+
{{#set: common-name=s-adenosyl-l-methionine}}
{{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}}
 
{{#set: molecular-weight=817.551}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite S-ADENOSYLMETHIONINE

  • common-name:
    • s-adenosyl-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality