Difference between revisions of "S-ALLANTOIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite XANTHOSINE-5-PHOSPHATE == * common-name: ** xmp * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-207 ==
+
== Metabolite XANTHOSINE-5-PHOSPHATE ==
 
* common-name:
 
* common-name:
** phenylacetyl-coa
+
** xmp
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
* inchi-key:
** zigifdrjfzyeeq-cecatxlmsa-j
+
** dctlyfzhfgencw-uuokfmhzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 881.637
+
** 362.192
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10821]]
+
* [[GMP-SYN-GLUT-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[X5NT]]
 +
* [[XMPXAN-RXN]]
 +
* [[XPPRT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[IMP-DEHYDROG-RXN]]
 +
* [[NTPD]]
 +
* [[RXN0-1603]]
 +
* [[XPPRT]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetyl-coa}}
+
{{#set: common-name=xmp}}
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
+
{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
{{#set: molecular-weight=881.637}}
+
{{#set: molecular-weight=362.192}}

Revision as of 11:19, 15 January 2021

Metabolite XANTHOSINE-5-PHOSPHATE

  • common-name:
    • xmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
  • inchi-key:
    • dctlyfzhfgencw-uuokfmhzsa-l
  • molecular-weight:
    • 362.192

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality