Difference between revisions of "S-ALLANTOIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite S-ALLANTOIN == * common-name: ** (s)-(+)-allantoin * smiles: ** c(=o)(n)n[ch]1(nc(=o)nc(=o)1) * inchi-key: ** pojwudadgalrab-sfowxeaesa-n...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-207 ==
+
== Metabolite S-ALLANTOIN ==
 
* common-name:
 
* common-name:
** phenylacetyl-coa
+
** (s)-(+)-allantoin
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c(=o)(n)n[ch]1(nc(=o)nc(=o)1)
 
* inchi-key:
 
* inchi-key:
** zigifdrjfzyeeq-cecatxlmsa-j
+
** pojwudadgalrab-sfowxeaesa-n
 
* molecular-weight:
 
* molecular-weight:
** 881.637
+
** 158.116
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10821]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6201]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetyl-coa}}
+
{{#set: common-name=(s)-(+)-allantoin}}
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
+
{{#set: inchi-key=inchikey=pojwudadgalrab-sfowxeaesa-n}}
{{#set: molecular-weight=881.637}}
+
{{#set: molecular-weight=158.116}}

Latest revision as of 11:18, 18 March 2021

Metabolite S-ALLANTOIN

  • common-name:
    • (s)-(+)-allantoin
  • smiles:
    • c(=o)(n)n[ch]1(nc(=o)nc(=o)1)
  • inchi-key:
    • pojwudadgalrab-sfowxeaesa-n
  • molecular-weight:
    • 158.116

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality