Difference between revisions of "S-CD-Apo-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-Aspartates == * common-name: ** a [protein]-l-aspartate == Reaction(s) known to consume the compound == * PEPTIDE-ASPARTATE-B...")
(Created page with "Category:metabolite == Metabolite CPD-206 == * common-name: ** phytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-L-Aspartates ==
+
== Metabolite CPD-206 ==
 
* common-name:
 
* common-name:
** a [protein]-l-aspartate
+
** phytanoyl-coa
 +
* smiles:
 +
** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** nrjqghhzmsouen-hhvnvsiesa-j
 +
* molecular-weight:
 +
** 1058.022
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
+
* [[1.14.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.5.1.52-RXN]]
+
* [[RXN66-482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-aspartate}}
+
{{#set: common-name=phytanoyl-coa}}
 +
{{#set: inchi-key=inchikey=nrjqghhzmsouen-hhvnvsiesa-j}}
 +
{{#set: molecular-weight=1058.022}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-206

  • common-name:
    • phytanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nrjqghhzmsouen-hhvnvsiesa-j
  • molecular-weight:
    • 1058.022

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality