Difference between revisions of "S-CD-S-SP-Complex"

Revision as of 11:18, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite ARG ==
+== Metabolite OLEATE-CPD ==
 * common-name:
-** l-arginine
+** oleate
 * smiles:
-** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
+** ccccccccc=ccccccccc([o-])=o
 * inchi-key:
-** odksfydxxfifqn-bypyzucnsa-o
+** zqppmhvwecsirj-ktkrtigzsa-m
 * molecular-weight:
-** 175.21
+** 281.457
 == Reaction(s) known to consume the compound ==
-* [[1.5.1.11-RXN]]
+* [[FACOAL18111Z]]
-* [[1.5.1.19-RXN]]
+* [[RXN-10756]]
-* [[ARG-OXIDATION-RXN]]
+* [[RXN-9644]]
-* [[ARGDECARBOX-RXN]]
+* [[RXN0-7239]]
-* [[ARGINASE-RXN]]
-* [[ARGININE--TRNA-LIGASE-RXN]]
-* [[ARGSUCCINLYA-RXN]]
-* [[NITRIC-OXIDE-SYNTHASE-RXN]]
-* [[RXN-13564]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ARGDECARBOX-RXN]]
+* [[FACOAE18111Z]]
-* [[ARGINASE-RXN]]
+* [[RXN-10756]]
-* [[ARGSUCCINLYA-RXN]]
+* [[RXN-15035]]
-* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
+* [[RXN-15067]]
+* [[RXN-15068]]
+* [[RXN-15088]]
+* [[RXN-15089]]
+* [[RXN-15133]]
+* [[RXN-15135]]
+* [[RXN-9666]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-arginine}}
+{{#set: common-name=oleate}}
-{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
+{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
-{{#set: molecular-weight=175.21}}
+{{#set: molecular-weight=281.457}}