Difference between revisions of "S-CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...") |
(Created page with "Category:metabolite == Metabolite Charged-SER-tRNAs == * common-name: ** an l-seryl-[trnaser] == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Charged-SER-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-seryl-[trnaser] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SERINE--TRNA-LIGASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-seryl-[trnaser]}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite Charged-SER-tRNAs
- common-name:
- an l-seryl-[trnaser]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an l-seryl-[trnaser" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
