Difference between revisions of "S-CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
(Created page with "Category:metabolite == Metabolite S-CD-S-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reac...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEATE-CPD ==
+
== Metabolite S-CD-S-SP-Complex ==
 
* common-name:
 
* common-name:
** oleate
+
** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
* smiles:
 
** ccccccccc=ccccccccc([o-])=o
 
* inchi-key:
 
** zqppmhvwecsirj-ktkrtigzsa-m
 
* molecular-weight:
 
** 281.457
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FACOAL18111Z]]
+
* [[RXN-14386]]
* [[RXN-10756]]
 
* [[RXN-9644]]
 
* [[RXN0-7239]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FACOAE18111Z]]
+
* [[RXN-14385]]
* [[RXN-10756]]
 
* [[RXN-15035]]
 
* [[RXN-15067]]
 
* [[RXN-15068]]
 
* [[RXN-15088]]
 
* [[RXN-15089]]
 
* [[RXN-15133]]
 
* [[RXN-15135]]
 
* [[RXN-9666]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleate}}
+
{{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}}
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
 
{{#set: molecular-weight=281.457}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite S-CD-S-SP-Complex

  • common-name:
    • an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.