Difference between revisions of "S-CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...") |
(Created page with "Category:metabolite == Metabolite S-CD-S-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reac...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-CD-S-SP-Complex == |
* common-name: | * common-name: | ||
| − | ** | + | ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-14386]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14385]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite S-CD-S-SP-Complex
- common-name:
- an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
