Difference between revisions of "S-CD-S-SP-Complex"

Revision as of 15:29, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-9859 ==
+== Metabolite OLEATE-CPD ==
 * common-name:
-** 6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol
+** oleate
 * smiles:
-** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c
+** ccccccccc=ccccccccc([o-])=o
 * inchi-key:
-** rohkdmwqxdhldy-hohoqcmasa-n
+** zqppmhvwecsirj-ktkrtigzsa-m
 * molecular-weight:
-** 630.993
+** 281.457
 == Reaction(s) known to consume the compound ==
+* [[FACOAL18111Z]]
+* [[RXN-10756]]
+* [[RXN-9644]]
+* [[RXN0-7239]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9227]]
+* [[FACOAE18111Z]]
+* [[RXN-10756]]
+* [[RXN-15035]]
+* [[RXN-15067]]
+* [[RXN-15068]]
+* [[RXN-15088]]
+* [[RXN-15089]]
+* [[RXN-15133]]
+* [[RXN-15135]]
+* [[RXN-9666]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6-methoxy-3-methyl-2-all-trans-heptaprenyl-1,4-benzoquinol}}
+{{#set: common-name=oleate}}
-{{#set: inchi-key=inchikey=rohkdmwqxdhldy-hohoqcmasa-n}}
+{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
-{{#set: molecular-weight=630.993}}
+{{#set: molecular-weight=281.457}}