Difference between revisions of "S-CD-S-SP-Complex"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Very-long-Chain-234-Saturated-acyl-CoAs == * common-name: ** a very-long-chain 2,3,4-saturated fatty acyl coa == Reaction(s) known to con...")
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite Very-long-Chain-234-Saturated-acyl-CoAs ==
+
== Metabolite ARG ==
 
* common-name:
 
* common-name:
−
** a very-long-chain 2,3,4-saturated fatty acyl coa
+
** l-arginine
 +
* smiles:
 +
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
 +
* inchi-key:
 +
** odksfydxxfifqn-bypyzucnsa-o
 +
* molecular-weight:
 +
** 175.21
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7697]]
+
* [[1.5.1.11-RXN]]
 +
* [[1.5.1.19-RXN]]
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[ARGDECARBOX-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 +
* [[RXN-13564]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARGDECARBOX-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=a very-long-chain 2,3,4-saturated fatty acyl coa}}
+
{{#set: common-name=l-arginine}}
 +
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
 +
{{#set: molecular-weight=175.21}}

Revision as of 18:57, 14 January 2021

Metabolite ARG

  • common-name:
    • l-arginine
  • smiles:
    • c(nc(n)=[n+])ccc([n+])c(=o)[o-]
  • inchi-key:
    • odksfydxxfifqn-bypyzucnsa-o
  • molecular-weight:
    • 175.21

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-CD-S-SP-Complex&oldid=99997"