Difference between revisions of "S-LACTOYL-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...") |
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SPERMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** spermine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ccc[n+]ccc[n+])[n+]ccc[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pfnffqxmrsdohw-uhfffaoysa-r |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.374 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SPERMINE-SYNTHASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=spermine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.374}} |
Revision as of 11:17, 15 January 2021
Contents
Metabolite SPERMINE
- common-name:
- spermine
- smiles:
- c(ccc[n+]ccc[n+])[n+]ccc[n+]
- inchi-key:
- pfnffqxmrsdohw-uhfffaoysa-r
- molecular-weight:
- 206.374
