Difference between revisions of "S-LACTOYL-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...") |
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N6-dimethyladenine1518-1519 == * common-name: ** n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 16S-rRNA-N6-dimethyladenine1518-1519 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11633]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna}} |
| − | |||
| − | |||
Revision as of 08:28, 15 March 2021
Contents
Metabolite 16S-rRNA-N6-dimethyladenine1518-1519
- common-name:
- n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna
