Difference between revisions of "S-LACTOYL-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N6-dimethyladenine1518-1519 == * common-name: ** n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna == Reaction(s) known t...")
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * smiles: ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 16S-rRNA-N6-dimethyladenine1518-1519 ==
+
== Metabolite S-LACTOYL-GLUTATHIONE ==
 
* common-name:
 
* common-name:
** n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna
+
** (r)-s-lactoylglutathione
 +
* smiles:
 +
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 +
* inchi-key:
 +
** vdydcvuwiliyqf-csmhccousa-m
 +
* molecular-weight:
 +
** 378.376
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXII-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11633]]
+
* [[GLYOXI-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-dimethyladenine1518/n6-dimethyladenine1519in 16s rrna}}
+
{{#set: common-name=(r)-s-lactoylglutathione}}
 +
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
 +
{{#set: molecular-weight=378.376}}

Latest revision as of 11:15, 18 March 2021

Metabolite S-LACTOYL-GLUTATHIONE

  • common-name:
    • (r)-s-lactoylglutathione
  • smiles:
    • cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • vdydcvuwiliyqf-csmhccousa-m
  • molecular-weight:
    • 378.376

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality