Difference between revisions of "S-LACTOYL-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-CINNAMATE-4-MONOOXYGENASE-RXN TRANS-CINNAMATE-4-MONOOXYGENASE-RXN] == * direction: ** left-to...")
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * smiles: ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-CINNAMATE-4-MONOOXYGENASE-RXN TRANS-CINNAMATE-4-MONOOXYGENASE-RXN] ==
+
== Metabolite S-LACTOYL-GLUTATHIONE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (r)-s-lactoylglutathione
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.13.11 ec-1.14.13.11]
+
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-674]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[COUMARATE]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c]
+
** vdydcvuwiliyqf-csmhccousa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11355]]
+
** 378.376
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GLYOXI-RXN]]
−
* Gene: [[SJ11349]]
+
* [[GLYOXII-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GLYOXI-RXN]]
−
* Gene: [[SJ11348]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(r)-s-lactoylglutathione}}
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
−
* Gene: [[SJ09087]]
+
{{#set: molecular-weight=378.376}}
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY1F-467]], phenylpropanoid biosynthesis, initial reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-467 PWY1F-467]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121]
 
−
** '''9''' reactions found over '''19''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10609 10609]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02253 R02253]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q04468 Q04468]
 
−
** [http://www.uniprot.org/uniprot/P37115 P37115]
 
−
** [http://www.uniprot.org/uniprot/Q9S8R8 Q9S8R8]
 
−
** [http://www.uniprot.org/uniprot/P48522 P48522]
 
−
** [http://www.uniprot.org/uniprot/Q42895 Q42895]
 
−
** [http://www.uniprot.org/uniprot/O81928 O81928]
 
−
** [http://www.uniprot.org/uniprot/O24315 O24315]
 
−
** [http://www.uniprot.org/uniprot/Q43033 Q43033]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.13.11}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite S-LACTOYL-GLUTATHIONE

  • common-name:
    • (r)-s-lactoylglutathione
  • smiles:
    • cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • vdydcvuwiliyqf-csmhccousa-m
  • molecular-weight:
    • 378.376

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-LACTOYL-GLUTATHIONE&oldid=138555"