Difference between revisions of "S-LACTOYL-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...")
(Created page with "Category:metabolite == Metabolite S-LACTOYL-GLUTATHIONE == * common-name: ** (r)-s-lactoylglutathione * smiles: ** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DCMP ==
+
== Metabolite S-LACTOYL-GLUTATHIONE ==
 
* common-name:
 
* common-name:
** dcmp
+
** (r)-s-lactoylglutathione
 
* smiles:
 
* smiles:
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
+
** cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** ncmvoabpesmrcp-shyzeuofsa-l
+
** vdydcvuwiliyqf-csmhccousa-m
 
* molecular-weight:
 
* molecular-weight:
** 305.183
+
** 378.376
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDCM]]
+
* [[GLYOXI-RXN]]
* [[DCMP-DEAMINASE-RXN]]
+
* [[GLYOXII-RXN]]
* [[RXN-7913]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
* [[GLYOXI-RXN]]
* [[RXN-14187]]
 
* [[RXN-14198]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dcmp}}
+
{{#set: common-name=(r)-s-lactoylglutathione}}
{{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}}
+
{{#set: inchi-key=inchikey=vdydcvuwiliyqf-csmhccousa-m}}
{{#set: molecular-weight=305.183}}
+
{{#set: molecular-weight=378.376}}

Latest revision as of 11:15, 18 March 2021

Metabolite S-LACTOYL-GLUTATHIONE

  • common-name:
    • (r)-s-lactoylglutathione
  • smiles:
    • cc(o)c(=o)scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • vdydcvuwiliyqf-csmhccousa-m
  • molecular-weight:
    • 378.376

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality