Difference between revisions of "S-LACTOYL-GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-34 RXN-34] == * direction: ** left-to-right * common-name: ** arginase * ec-number: ** [http://...")
(Created page with "Category:metabolite == Metabolite CPD-10546 == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) * inchi-key: ** kthadmdgdnyqrx-uhf...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-34 RXN-34] ==
+
== Metabolite CPD-10546 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** arginase
+
** methyl (indol-3-yl)acetate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.3.1 ec-3.5.3.1]
+
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CANAVANINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-CANALINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UREA]][c]
+
** kthadmdgdnyqrx-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ12906]]
+
** 189.213
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10711]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=methyl (indol-3-yl)acetate}}
−
* [[PWY-31]], canavanine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-31 PWY-31]
+
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: molecular-weight=189.213}}
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=arginase}}
 
−
{{#set: ec-number=ec-3.5.3.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-10546

  • common-name:
    • methyl (indol-3-yl)acetate
  • smiles:
    • coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
  • inchi-key:
    • kthadmdgdnyqrx-uhfffaoysa-n
  • molecular-weight:
    • 189.213

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-LACTOYL-GLUTATHIONE&oldid=47371"