Difference between revisions of "S-LACTOYL-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10546 == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) * inchi-key: ** kthadmdgdnyqrx-uhf...") |
(Created page with "Category:metabolite == Metabolite L-GULONATE == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-qtbdoelssa-m * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-GULONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-gulonate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghnjxzeokukbd-qtbdoelssa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUCURONATE-REDUCTASE-RXN]] | ||
| + | * [[RXN-8783]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-gulonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite L-GULONATE
- common-name:
- l-gulonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-qtbdoelssa-m
- molecular-weight:
- 195.149
