Difference between revisions of "S-LACTOYL-GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRALDEHYDE == * common-name: ** 4-aminobutanal * smiles: ** c(c[n+])cc=o * inchi-key: ** dzqlqeyleywjib-uhfffaoysa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DCMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dcmp |
* smiles: | * smiles: | ||
| − | ** c(c[ | + | ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ncmvoabpesmrcp-shyzeuofsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 305.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ATDCM]] |
| + | * [[DCMP-DEAMINASE-RXN]] | ||
| + | * [[RXN-7913]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DCTP-PYROPHOSPHATASE-RXN]] |
| + | * [[RXN-14187]] | ||
| + | * [[RXN-14198]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dcmp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=305.183}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite DCMP
- common-name:
- dcmp
- smiles:
- c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
- inchi-key:
- ncmvoabpesmrcp-shyzeuofsa-l
- molecular-weight:
- 305.183
