Difference between revisions of "S-N-METHYLCOCLAURINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * smiles: ** cc(c)c(o)(cc(=o)[o-])c([o-])=o * inchi-key: ** b...") |
(Created page with "Category:metabolite == Metabolite S-N-METHYLCOCLAURINE == * common-name: ** (s)-n-methylcoclaurine * smiles: ** c1([n+]([ch](c2(=c(c1)c=c(c(=c2)o)oc))cc3(=cc=c(c=c3)o))c)...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-N-METHYLCOCLAURINE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (s)-n-methylcoclaurine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1([n+]([ch](c2(=c(c1)c=c(c(=c2)o)oc))cc3(=cc=c(c=c3)o))c) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bokvlbssputwlv-inizcteosa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 300.377 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2 | + | * [[2.1.1.140-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(s)-n-methylcoclaurine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bokvlbssputwlv-inizcteosa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.377}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite S-N-METHYLCOCLAURINE
- common-name:
- (s)-n-methylcoclaurine
- smiles:
- c1([n+]([ch](c2(=c(c1)c=c(c(=c2)o)oc))cc3(=cc=c(c=c3)o))c)
- inchi-key:
- bokvlbssputwlv-inizcteosa-o
- molecular-weight:
- 300.377
