Difference between revisions of "S-NITROSOGLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21621 == * transcription-direction: ** negative * right-end-position: ** 95306 * left-end-position: ** 88977 * centisome-position: ** 47.08924...") |
(Created page with "Category:metabolite == Metabolite S-NITROSOGLUTATHIONE == * common-name: ** s-nitrosoglutathione * smiles: ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-ke...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite S-NITROSOGLUTATHIONE == |
| − | * | + | * common-name: |
| − | ** | + | ** s-nitrosoglutathione |
| − | * | + | * smiles: |
| − | ** | + | ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** hyhsbsxuhzoylx-wdskdsinsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 335.311 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17884]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=s-nitrosoglutathione}} | |
| − | + | {{#set: inchi-key=inchikey=hyhsbsxuhzoylx-wdskdsinsa-m}} | |
| − | {{#set: | + | {{#set: molecular-weight=335.311}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite S-NITROSOGLUTATHIONE
- common-name:
- s-nitrosoglutathione
- smiles:
- c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- hyhsbsxuhzoylx-wdskdsinsa-m
- molecular-weight:
- 335.311
