Difference between revisions of "S-NORCOCLAURINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-653 == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-653 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-nadhx |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** idbzkgqrlbfufq-vphrtnkssa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 681.445 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4.2.1.93-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12752]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-nadhx}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=idbzkgqrlbfufq-vphrtnkssa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=681.445}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-653
- common-name:
- (s)-nadhx
- smiles:
- c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
- inchi-key:
- idbzkgqrlbfufq-vphrtnkssa-l
- molecular-weight:
- 681.445
