Difference between revisions of "S-NORCOCLAURINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8772 RXN-8772] == * direction: ** reversible * common-name: ** l-arabinose reductase * ec-numbe...")
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8772 RXN-8772] ==
+
== Metabolite CPD-401 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** l-arabinose reductase
+
** anserine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.21 ec-1.1.1.21]
+
** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[L-ARABITOL]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[L-arabinopyranose]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
+
** myyiahxivfadcu-qmmmgpobsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05644]]
+
** 240.261
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[X-METHYL-HIS-DIPEPTIDASE-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-5515]], L-arabinose degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5515 PWY-5515]
+
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=anserine}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=myyiahxivfadcu-qmmmgpobsa-n}}
−
== External links  ==
+
{{#set: molecular-weight=240.261}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25232 25232]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01759 R01759]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=l-arabinose reductase}}
 
−
{{#set: ec-number=ec-1.1.1.21}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-401

  • common-name:
    • anserine
  • smiles:
    • cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o)
  • inchi-key:
    • myyiahxivfadcu-qmmmgpobsa-n
  • molecular-weight:
    • 240.261

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-NORCOCLAURINE&oldid=47307"