Difference between revisions of "S-PRENYL-L-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17951 RXN-17951] == * direction: ** left-to-right * common-name: ** glycine oxidase * ec-number...")
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17951 RXN-17951] ==
+
== Metabolite S-PRENYL-L-CYSTEINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** glycine oxidase
+
** s-prenyl-l-cysteine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.19 ec-1.4.3.19]
+
** cc(c)=ccscc([n+])c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD0-1308]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-1074]][c] '''+''' 1 [[GLYOX]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
** ulhwznasvjioem-zetcqymhsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ17412]]
+
** 189.272
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[1.8.3.5-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7806]], glyphosate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7806 PWY-7806]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
{{#set: common-name=s-prenyl-l-cysteine}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ulhwznasvjioem-zetcqymhsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=189.272}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=52741 52741]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=glycine oxidase}}
 
−
{{#set: ec-number=ec-1.4.3.19}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite S-PRENYL-L-CYSTEINE

  • common-name:
    • s-prenyl-l-cysteine
  • smiles:
    • cc(c)=ccscc([n+])c(=o)[o-]
  • inchi-key:
    • ulhwznasvjioem-zetcqymhsa-n
  • molecular-weight:
    • 189.272

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-PRENYL-L-CYSTEINE&oldid=139129"