Difference between revisions of "S-PRENYL-L-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] == * direction: ** left-...")
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN] ==
+
== Metabolite S-PRENYL-L-CYSTEINE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 5'-methylthioadenosine nucleosidase
+
** s-prenyl-l-cysteine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.2.2.16 ec-3.2.2.16]
+
** cc(c)=ccscc([n+])c(=o)[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADENINE]][c] '''+''' 1 [[CPD-560]][c]
+
** ulhwznasvjioem-zetcqymhsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ14933]]
+
** 189.272
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.8.3.5-RXN]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ02916]]
+
{{#set: common-name=s-prenyl-l-cysteine}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ulhwznasvjioem-zetcqymhsa-n}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=189.272}}
== Pathway(s) ==
 
* [[PWY-6754]], S-methyl-5'-thioadenosine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6754 PWY-6754]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY0-1391]], S-methyl-5'-thioadenosine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1391 PWY0-1391]
 
** '''1''' reactions found over '''1''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13618 13618]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01401 R01401]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=5'-methylthioadenosine nucleosidase}}
 
{{#set: ec-number=ec-3.2.2.16}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite S-PRENYL-L-CYSTEINE

  • common-name:
    • s-prenyl-l-cysteine
  • smiles:
    • cc(c)=ccscc([n+])c(=o)[o-]
  • inchi-key:
    • ulhwznasvjioem-zetcqymhsa-n
  • molecular-weight:
    • 189.272

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality