Difference between revisions of "S-PRENYL-L-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYTIDINE == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...") |
(Created page with "Category:metabolite == Metabolite S-PRENYL-L-CYSTEINE == * common-name: ** s-prenyl-l-cysteine * smiles: ** cc(c)=ccscc([n+])c(=o)[o-] * inchi-key: ** ulhwznasvjioem-zetcq...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-PRENYL-L-CYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-prenyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=ccscc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ulhwznasvjioem-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.8.3.5-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-prenyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ulhwznasvjioem-zetcqymhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.272}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite S-PRENYL-L-CYSTEINE
- common-name:
- s-prenyl-l-cysteine
- smiles:
- cc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- ulhwznasvjioem-zetcqymhsa-n
- molecular-weight:
- 189.272
