Difference between revisions of "S-PRENYL-L-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYTIDINE == * common-name: ** cytidine * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n...")
(Created page with "Category:metabolite == Metabolite Peptides-with-Leader-Sequence == * common-name: ** a peptide with a leader sequence == Reaction(s) known to consume the compound == * 3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYTIDINE ==
+
== Metabolite Peptides-with-Leader-Sequence ==
 
* common-name:
 
* common-name:
** cytidine
+
** a peptide with a leader sequence
* smiles:
 
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
 
* inchi-key:
 
** uhdgcwiwmrvcdj-xvfcmesisa-n
 
* molecular-weight:
 
** 243.219
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCY]]
+
* [[3.4.21.89-RXN]]
* [[ATDTD]]
 
* [[ATDTDm]]
 
* [[CYTIDEAM2-RXN]]
 
* [[DATCY]]
 
* [[DCTCP]]
 
* [[DGTCY]]
 
* [[DTTGY]]
 
* [[DTTPtm]]
 
* [[DUTCP]]
 
* [[GTCY]]
 
* [[ITCY]]
 
* [[RXN0-361]]
 
* [[UTCY]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATDTM]]
 
* [[DTTGY]]
 
* [[DTTPtm]]
 
* [[DTTUP]]
 
* [[RXN-14026]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine}}
+
{{#set: common-name=a peptide with a leader sequence}}
{{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}}
 
{{#set: molecular-weight=243.219}}
 

Revision as of 14:59, 5 January 2021

Metabolite Peptides-with-Leader-Sequence

  • common-name:
    • a peptide with a leader sequence

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality