Difference between revisions of "S-Substituted-Glutathione"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8326 RXN-8326] == * direction: ** left-to-right * common-name: ** 1-18:1-2-18:2-phosphatidylcho...")
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8326 RXN-8326] ==
+
== Metabolite CPD-11403 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 1-18:1-2-18:2-phosphatidylcholine desaturase
+
** tetraiodothyroacetate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.19.25 ec-1.14.19.25]
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-8091]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-8092]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** ppjyssnksxavdb-uhfffaoysa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ09228]]
+
** 746.825
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10616]]
* Gene: [[SJ03069]]
+
* [[RXN-10617]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=tetraiodothyroacetate}}
* [[PWY-762]], phospholipid desaturation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-762 PWY-762]
+
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
** '''19''' reactions found over '''21''' reactions in the full pathway
+
{{#set: molecular-weight=746.825}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=1-18:1-2-18:2-phosphatidylcholine desaturase}}
 
{{#set: ec-number=ec-1.14.19.25}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-11403

  • common-name:
    • tetraiodothyroacetate
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
  • inchi-key:
    • ppjyssnksxavdb-uhfffaoysa-m
  • molecular-weight:
    • 746.825

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality