Difference between revisions of "S-Substituted-Glutathione"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8326 RXN-8326] == * direction: ** left-to-right * common-name: ** 1-18:1-2-18:2-phosphatidylcho...") |
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11403 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** tetraiodothyroacetate |
− | * | + | * smiles: |
− | ** | + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) |
− | = | + | * inchi-key: |
− | + | ** ppjyssnksxavdb-uhfffaoysa-m | |
− | == | + | * molecular-weight: |
− | * | + | ** 746.825 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10616]] |
− | + | * [[RXN-10617]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=tetraiodothyroacetate}} |
− | * [[ | + | {{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}} |
− | + | {{#set: molecular-weight=746.825}} | |
− | == | ||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-11403
- common-name:
- tetraiodothyroacetate
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
- inchi-key:
- ppjyssnksxavdb-uhfffaoysa-m
- molecular-weight:
- 746.825