Difference between revisions of "S-Substituted-L-Cysteines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DUDP == * common-name: ** dudp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** qhwztvccbmii...")
(Created page with "Category:metabolite == Metabolite S-Substituted-L-Cysteines == * common-name: ** an l-cysteine-s-conjugate == Reaction(s) known to consume the compound == * RXN-15582...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DUDP ==
+
== Metabolite S-Substituted-L-Cysteines ==
 
* common-name:
 
* common-name:
** dudp
+
** an l-cysteine-s-conjugate
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n2(c=cc(=o)nc(=o)2))
 
* inchi-key:
 
** qhwztvccbmiike-shyzeuofsa-k
 
* molecular-weight:
 
** 385.14
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDUD]]
+
* [[RXN-15582]]
* [[ATDUDm]]
+
* [[RXN-6763]]
* [[DUDPKIN-RXN]]
 
* [[RXN-14220]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DUDT]]
+
* [[RXN-13684]]
* [[DUTCP]]
+
* [[RXN-6642]]
* [[DUTUP]]
 
* [[RXN-14219]]
 
* [[RXN0-722]]
 
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dudp}}
+
{{#set: common-name=an l-cysteine-s-conjugate}}
{{#set: inchi-key=inchikey=qhwztvccbmiike-shyzeuofsa-k}}
 
{{#set: molecular-weight=385.14}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite S-Substituted-L-Cysteines

  • common-name:
    • an l-cysteine-s-conjugate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality