Difference between revisions of "S-ubiquitinyl-HECT-E3-UCP-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...") |
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PHENYL-PYRUVATE == |
* common-name: | * common-name: | ||
− | ** | + | ** keto-phenylpyruvate |
* smiles: | * smiles: | ||
− | ** | + | ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** btnmpgbkdvtsjy-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 163.152 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.6.1.64-RXN]] |
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[PREPHENATEDEHYDRAT-RXN]] | ||
+ | * [[RXN-10814]] | ||
+ | * [[RXN-10815]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2.6.1.64-RXN]] |
+ | * [[PHEAMINOTRANS-RXN]] | ||
+ | * [[PPDH]] | ||
+ | * [[PREPHENATEDEHYDRAT-RXN]] | ||
+ | * [[RXN-10814]] | ||
+ | * [[RXN-17130]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=keto-phenylpyruvate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=163.152}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite PHENYL-PYRUVATE
- common-name:
- keto-phenylpyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cc=cc=c1)
- inchi-key:
- btnmpgbkdvtsjy-uhfffaoysa-m
- molecular-weight:
- 163.152