Difference between revisions of "S-ubiquitinyl-UAP-E1-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15688 == * common-name: ** (3z,5e)-dodeca-3,5-dienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-UAP-E1-L-cysteine == * common-name: ** an [e1 ubiquitin-activating enzyme]-s-ubiquitinyl-l-cysteine == Reaction(s) known to...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15688 ==
+
== Metabolite S-ubiquitinyl-UAP-E1-L-cysteine ==
 
* common-name:
 
* common-name:
** (3z,5e)-dodeca-3,5-dienoyl-coa
+
** an [e1 ubiquitin-activating enzyme]-s-ubiquitinyl-l-cysteine
* smiles:
 
** ccccccc=cc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** arquzfjqpywssl-nbluimthsa-j
 
* molecular-weight:
 
** 941.776
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15556]]
 +
* [[RXN-15563]]
 +
* [[RXN-15565]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14799]]
+
* [[RXN-15565]]
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z,5e)-dodeca-3,5-dienoyl-coa}}
+
{{#set: common-name=an [e1 ubiquitin-activating enzyme]-s-ubiquitinyl-l-cysteine}}
{{#set: inchi-key=inchikey=arquzfjqpywssl-nbluimthsa-j}}
 
{{#set: molecular-weight=941.776}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite S-ubiquitinyl-UAP-E1-L-cysteine

  • common-name:
    • an [e1 ubiquitin-activating enzyme]-s-ubiquitinyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [e1 ubiquitin-activating enzyme]-s-ubiquitinyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.