Difference between revisions of "SACCHAROPINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20291 == * transcription-direction: ** positive * right-end-position: ** 124848 * left-end-position: ** 123940 * centisome-position: ** 59.21842...")
 
(Created page with "Category:metabolite == Metabolite SACCHAROPINE == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o * inchi-key: ** zdgjahtzv...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ20291 ==
+
== Metabolite SACCHAROPINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-saccharopine
−
* right-end-position:
+
* smiles:
−
** 124848
+
** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 123940
+
** zdgjahtzvhvlot-yumqzzprsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 59.21842   
+
** 275.281
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.5.1.9-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
+
{{#set: common-name=l-saccharopine}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=275.281}}
−
* [[ESTRADIOL-17-BETA-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[HBNOm]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RETINOL-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12581]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17728]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-368]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY66-367]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY66-380]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6872]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7782]]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=124848}}
 
−
{{#set: left-end-position=123940}}
 
−
{{#set: centisome-position=59.21842    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite SACCHAROPINE

  • common-name:
    • l-saccharopine
  • smiles:
    • c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
  • inchi-key:
    • zdgjahtzvhvlot-yumqzzprsa-m
  • molecular-weight:
    • 275.281

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SACCHAROPINE&oldid=138306"