Difference between revisions of "SACCHAROPINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-...") |
(Created page with "Category:metabolite == Metabolite PHENYL == * common-name: ** acetophenone * smiles: ** cc(=o)c1(c=cc=cc=1) * inchi-key: ** kwolfjpfchcocg-uhfffaoysa-n * molecular-weight:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHENYL == |
* common-name: | * common-name: | ||
| − | ** | + | ** acetophenone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)c1(c=cc=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kwolfjpfchcocg-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 120.151 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1302]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1302]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=acetophenone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kwolfjpfchcocg-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=120.151}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite PHENYL
- common-name:
- acetophenone
- smiles:
- cc(=o)c1(c=cc=cc=1)
- inchi-key:
- kwolfjpfchcocg-uhfffaoysa-n
- molecular-weight:
- 120.151
