Difference between revisions of "SALVPURINE2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c(...")
(Created page with "Category:pathway == Pathway SALVPURINE2-PWY == * taxonomic-range: ** tax-2157 ** tax-2 ** tax-2759 * common-name: ** xanthine and xanthosine salvage == Reaction(s) found =...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
+
== Pathway SALVPURINE2-PWY ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2
 +
** tax-2759
 
* common-name:
 
* common-name:
** l-thyroxine acyl β-d-glucuronide
+
** xanthine and xanthosine salvage
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
+
* [[XANTHOSINEPHOSPHORY-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** hmtfxpjobpioin-dkbymcrtsa-m
+
* [NoneXANPRIBOSYLTRAN-RXN XANPRIBOSYLTRAN-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
** 951.992
+
{{#set: common-name=xanthine and xanthosine salvage}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[RXN-10608]]
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=l-thyroxine acyl β-d-glucuronide}}
 
{{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}}
 
{{#set: molecular-weight=951.992}}
 

Latest revision as of 10:57, 18 March 2021

Pathway SALVPURINE2-PWY

  • taxonomic-range:
    • tax-2157
    • tax-2
    • tax-2759
  • common-name:
    • xanthine and xanthosine salvage

Reaction(s) found

Reaction(s) not found

  • [NoneXANPRIBOSYLTRAN-RXN XANPRIBOSYLTRAN-RXN]